CAS 1824839-61-3 is the registry number for 4-Methyl-n1-[(1e)-(4-methylphenyl)methylene]-1h-imidazole-1,2-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-methyl-1-[(E)-(4-methylphenyl)methylideneamino]imidazol-2-amine (CAS 1824839-61-3) is a chemical compound with the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. IUPAC name: 4-methyl-1-[(E)-(4-methylphenyl)methylideneamino]imidazol-2-amine. InChIKey: HPFFXBXSHAUWMB-VGOFMYFVSA-N.
| Molecular formula | C12H14N4 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | 4-methyl-1-[(E)-(4-methylphenyl)methylideneamino]imidazol-2-amine |
| InChIKey | HPFFXBXSHAUWMB-VGOFMYFVSA-N |
| SMILES | CC1=CC=C(C=C1)/C=N/N2C=C(N=C2N)C |
Computed by PubChem (NCBI)