CAS 51987-10-1 is the registry number for [1,1'-Biphenyl]-3,3',5,5'-tetraamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-diaminophenyl)benzene-1,3-diamine (CAS 51987-10-1) is a chemical compound with the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. IUPAC name: 5-(3,5-diaminophenyl)benzene-1,3-diamine. InChIKey: AUSJTZCDDYIJDX-UHFFFAOYSA-N.
| Molecular formula | C12H14N4 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | 5-(3,5-diaminophenyl)benzene-1,3-diamine |
| InChIKey | AUSJTZCDDYIJDX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)N)C2=CC(=CC(=C2)N)N |
Computed by PubChem (NCBI)