CAS 81261-93-0 appears in our catalog under these names: 2-[N-(4-Aminophenyl)amino]-4,6-dimethylpyrimidine, 95%, N1-(4,6-Dimethylpyrimidin-2-yl)benzene-1,4-diamine 95%, 2-[N-(4-Aminophenyl)amino]-4,6-dimethylpyrimidine, 95%, 95%, N-(4,6-Dimethylpyrimidin-2-yl)benzene-1,4-diamine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
4-N-(4,6-dimethylpyrimidin-2-yl)benzene-1,4-diamine (CAS 81261-93-0) is a chemical compound with the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. IUPAC name: 4-N-(4,6-dimethylpyrimidin-2-yl)benzene-1,4-diamine. InChIKey: SFVBOQCTJBQABR-UHFFFAOYSA-N.
| Molecular formula | C12H14N4 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | 4-N-(4,6-dimethylpyrimidin-2-yl)benzene-1,4-diamine |
| InChIKey | SFVBOQCTJBQABR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)