CAS 1824839-65-7 appears in our catalog under these names: 3-(2-Chloro-4-(ethylamino)pyrimidin-5-yl)acrylic acid, 95%, (E)-3-(2-CHLORO-4-(ETHYLAMINO)PYRIMIDIN-5-YL)ACRYLIC ACID, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg.
(E)-3-[2-chloro-4-(ethylamino)pyrimidin-5-yl]prop-2-enoic acid (CAS 1824839-65-7) is a chemical compound with the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. IUPAC name: (E)-3-[2-chloro-4-(ethylamino)pyrimidin-5-yl]prop-2-enoic acid. InChIKey: IUDDRJFCKDRQBW-ONEGZZNKSA-N.
| Molecular formula | C9H10ClN3O2 |
|---|---|
| Molecular weight | 227.65 g/mol |
| IUPAC name | (E)-3-[2-chloro-4-(ethylamino)pyrimidin-5-yl]prop-2-enoic acid |
| InChIKey | IUDDRJFCKDRQBW-ONEGZZNKSA-N |
| SMILES | CCNC1=NC(=NC=C1/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)