CAS 2059932-81-7 appears in our catalog under these names: 5-(4-Aminophenyl)imidazolidine-2,4-dione hydrochloride, 95%, 5-(4-Aminophenyl)imidazolidine-2,4-dione hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(4-aminophenyl)imidazolidine-2,4-dione;hydrochloride (CAS 2059932-81-7) is a chemical compound with the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. IUPAC name: 5-(4-aminophenyl)imidazolidine-2,4-dione;hydrochloride. InChIKey: YBODXAHVCQHJMK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O2 |
|---|---|
| Molecular weight | 227.65 g/mol |
| IUPAC name | 5-(4-aminophenyl)imidazolidine-2,4-dione;hydrochloride |
| InChIKey | YBODXAHVCQHJMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2C(=O)NC(=O)N2)N.Cl |
Computed by PubChem (NCBI)