CAS 2189434-98-6 is the registry number for 5,7-Dimethylpyrazolo(1,5-a)pyrimidine-2-carboxylic acid hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid;hydrochloride (CAS 2189434-98-6) is a chemical compound with the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. IUPAC name: 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid;hydrochloride. InChIKey: DEULFMQYVHVRKE-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O2 |
|---|---|
| Molecular weight | 227.65 g/mol |
| IUPAC name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid;hydrochloride |
| InChIKey | DEULFMQYVHVRKE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=CC(=NN12)C(=O)O)C.Cl |
Computed by PubChem (NCBI)