Products 182498-30-2
CAS 182498-30-2 appears in our catalog under these names: CXCR2 antagonist 8, CXCR2 antagonist 8, CXCR2 antagonist 8, 98.38%, CXCR2 antagonist 8, 97%. Offered by: TargetMol, GLPBio, MedChemExpress, Ambeed. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg, 10mM/1mL.
1-(2-hydroxy-4-nitrophenyl)-3-(2-methoxyphenyl)urea (CAS 182498-30-2) is a chemical compound with the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. IUPAC name: 1-(2-hydroxy-4-nitrophenyl)-3-(2-methoxyphenyl)urea. InChIKey: KNPLCJZGNRGZAN-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | 1-(2-hydroxy-4-nitrophenyl)-3-(2-methoxyphenyl)urea |
| InChIKey | KNPLCJZGNRGZAN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC(=O)NC2=C(C=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)