Products 869895-64-7

CAS 869895-64-7 is the registry number for Dimethyl 1-(2-oxo-2-phenylethyl)-1h-1,2,3-triazole-4,5-dicarboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 1-phenacyltriazole-4,5-dicarboxylate (CAS 869895-64-7) is a chemical compound with the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. IUPAC name: dimethyl 1-phenacyltriazole-4,5-dicarboxylate. InChIKey: UXIKHYQVKAZWBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13N3O5
Molecular weight303.27 g/mol
IUPAC namedimethyl 1-phenacyltriazole-4,5-dicarboxylate
InChIKeyUXIKHYQVKAZWBQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(N(N=N1)CC(=O)C2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)