CAS 869895-64-7 is the registry number for Dimethyl 1-(2-oxo-2-phenylethyl)-1h-1,2,3-triazole-4,5-dicarboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Dimethyl 1-phenacyltriazole-4,5-dicarboxylate (CAS 869895-64-7) is a chemical compound with the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. IUPAC name: dimethyl 1-phenacyltriazole-4,5-dicarboxylate. InChIKey: UXIKHYQVKAZWBQ-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | dimethyl 1-phenacyltriazole-4,5-dicarboxylate |
| InChIKey | UXIKHYQVKAZWBQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=N1)CC(=O)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)