Products 2154355-10-7
CAS 2154355-10-7 is the registry number for Pomalidomide 7'OMe. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-2-(2,6-dioxopiperidin-3-yl)-7-methoxyisoindole-1,3-dione (CAS 2154355-10-7) is a chemical compound with the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. IUPAC name: 4-amino-2-(2,6-dioxopiperidin-3-yl)-7-methoxyisoindole-1,3-dione. InChIKey: JQKAGYPIPZUGHW-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O5 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | 4-amino-2-(2,6-dioxopiperidin-3-yl)-7-methoxyisoindole-1,3-dione |
| InChIKey | JQKAGYPIPZUGHW-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)N)C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)