CAS 1825352-87-1 is the registry number for Risdiplam Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-7-fluoropyrido[1,2-a]pyrimidin-4-one (CAS 1825352-87-1) is a chemical compound with the molecular formula C16H12FN5O and a molecular weight of 309.30 g/mol. IUPAC name: 2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-7-fluoropyrido[1,2-a]pyrimidin-4-one. InChIKey: NWNRNQCUKDLGMJ-UHFFFAOYSA-N.
| Molecular formula | C16H12FN5O |
|---|---|
| Molecular weight | 309.30 g/mol |
| IUPAC name | 2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | NWNRNQCUKDLGMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN2C1=NC(=C2)C)C3=CC(=O)N4C=C(C=CC4=N3)F |
Computed by PubChem (NCBI)