CAS 328962-06-7 is the registry number for 4-(1-(4-Fluoro-benzyl)-1H-benzoimidazol-2-yl)-furazan-3-ylamine. Offered by: Biosynth. Available pack sizes: 1000mg.
4-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-amine (CAS 328962-06-7) is a chemical compound with the molecular formula C16H12FN5O and a molecular weight of 309.30 g/mol. IUPAC name: 4-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-amine. InChIKey: VZSANIPPAPURMC-UHFFFAOYSA-N.
| Molecular formula | C16H12FN5O |
|---|---|
| Molecular weight | 309.30 g/mol |
| IUPAC name | 4-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-1,2,5-oxadiazol-3-amine |
| InChIKey | VZSANIPPAPURMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CC3=CC=C(C=C3)F)C4=NON=C4N |
Computed by PubChem (NCBI)