CAS 443103-97-7 appears in our catalog under these names: A2A receptor antagonist 1/ 99.76% (existing batch purity), A2A receptor antagonist 1, A2AR antagonist 1, ≥99%, ≥99%, A2A receptor antagonist 1, 99.88%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
1-[(2-fluorophenyl)methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine (CAS 443103-97-7) is a chemical compound with the molecular formula C16H12FN5O and a molecular weight of 309.30 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine. InChIKey: JEEJMSUHUZNTCD-UHFFFAOYSA-N.
| Molecular formula | C16H12FN5O |
|---|---|
| Molecular weight | 309.30 g/mol |
| IUPAC name | 1-[(2-fluorophenyl)methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine |
| InChIKey | JEEJMSUHUZNTCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C3=NC(=NC(=C3C=N2)C4=CC=CO4)N)F |
Computed by PubChem (NCBI)