Products 182863-41-8
CAS 182863-41-8 appears in our catalog under these names: 1,3,5–Triethynyl–2,4,6–trimethylbenzene, 1,3,5-Triethynyl-2,4,6-Trimethylbenzene, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1,3,5-triethynyl-2,4,6-trimethylbenzene (CAS 182863-41-8) is a chemical compound with the molecular formula C15H12 and a molecular weight of 192.25 g/mol. IUPAC name: 1,3,5-triethynyl-2,4,6-trimethylbenzene. InChIKey: XEDZBDOSUIBXKC-UHFFFAOYSA-N.
| Molecular formula | C15H12 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1,3,5-triethynyl-2,4,6-trimethylbenzene |
| InChIKey | XEDZBDOSUIBXKC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C#C)C)C#C)C)C#C |
Computed by PubChem (NCBI)