CAS 182949-55-9 is the registry number for 4-Methyl-N-(1-(2-naphthalenyl)ethylidene)benzenesulfonamide. Offered by: TRC. Available pack sizes: 2,5g.
4-methyl-N-(1-naphthalen-2-ylethylidene)benzenesulfonamide (CAS 182949-55-9) is a chemical compound with the molecular formula C19H17NO2S and a molecular weight of 323.4 g/mol. IUPAC name: 4-methyl-N-(1-naphthalen-2-ylethylidene)benzenesulfonamide. InChIKey: WHWCYPRDJIKMQH-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 4-methyl-N-(1-naphthalen-2-ylethylidene)benzenesulfonamide |
| InChIKey | WHWCYPRDJIKMQH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N=C(C)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)