CAS 4703-19-9 is the registry number for N,N-Diphenyl-p-toluenesulfonamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
4-methyl-N,N-diphenylbenzenesulfonamide (CAS 4703-19-9) is a chemical compound with the molecular formula C19H17NO2S and a molecular weight of 323.4 g/mol. IUPAC name: 4-methyl-N,N-diphenylbenzenesulfonamide. InChIKey: VLYSRNWCIRFSSM-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 4-methyl-N,N-diphenylbenzenesulfonamide |
| InChIKey | VLYSRNWCIRFSSM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)