Products 43076-16-0
CAS 43076-16-0 appears in our catalog under these names: Ketotifen EP Impurity G, 9,10-Dioxo Ketotifen, >95% (HPLC), 4-(1-Methylpiperidin-4-ylidene)-4H-benzo(4,5)cyclohepta(1,2-b)thiophen-9,10-dione (9,10-Dioxoketotifen), 9,10-Dioxo ketotifen, KETOTIFEN RELATED COMPOUND G. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 2mg, 1mg, 5mg, 30MG.
2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaene-8,9-dione (CAS 43076-16-0) is a chemical compound with the molecular formula C19H17NO2S and a molecular weight of 323.4 g/mol. IUPAC name: 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaene-8,9-dione. InChIKey: SEWPKRUDHMXTMH-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaene-8,9-dione |
| InChIKey | SEWPKRUDHMXTMH-UHFFFAOYSA-N |
| SMILES | CN1CCC(=C2C3=C(C(=O)C(=O)C4=CC=CC=C42)SC=C3)CC1 |
Computed by PubChem (NCBI)