Products 1829549-86-1
CAS 1829549-86-1 is the registry number for (S)-5-Bromocoerulescine. Offered by: TRC. Available pack sizes: 25mg.
(3S)-5-bromo-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one (CAS 1829549-86-1) is a chemical compound with the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. IUPAC name: (3S)-5-bromo-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one. InChIKey: RQZYHCADOCKYEL-GFCCVEGCSA-N.
| Molecular formula | C12H13BrN2O |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | (3S)-5-bromo-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| InChIKey | RQZYHCADOCKYEL-GFCCVEGCSA-N |
| SMILES | CN1CC[C@@]2(C1)C3=C(C=CC(=C3)Br)NC2=O |
Computed by PubChem (NCBI)