CAS 1829558-56-6 is the registry number for Ezetimibe Impurity 127. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2-fluorophenyl)iminomethyl]phenol (CAS 1829558-56-6) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: 4-[(2-fluorophenyl)iminomethyl]phenol. InChIKey: OCRFUNRPDDJLGI-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | 4-[(2-fluorophenyl)iminomethyl]phenol |
| InChIKey | OCRFUNRPDDJLGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=CC2=CC=C(C=C2)O)F |
Computed by PubChem (NCBI)