CAS 182958-73-2 is the registry number for Carbamic acid, [2-hydroxy-1-(hydroxymethyl)-2-methylpropyl]-, 1,1-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[(2S)-1,3-dihydroxy-3-methylbutan-2-yl]carbamate (CAS 182958-73-2) is a chemical compound with the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. IUPAC name: tert-butyl N-[(2S)-1,3-dihydroxy-3-methylbutan-2-yl]carbamate. InChIKey: ZCNIHVVSMKRMGN-ZETCQYMHSA-N.
| Molecular formula | C10H21NO4 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1,3-dihydroxy-3-methylbutan-2-yl]carbamate |
| InChIKey | ZCNIHVVSMKRMGN-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(C)(C)O |
Computed by PubChem (NCBI)