Products 1829966-40-6

CAS 1829966-40-6 is the registry number for 4-(2,3-Dihydrobenzo[f][1,4]oxazepin-4(5H)-yl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butanoic acid (CAS 1829966-40-6) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butanoic acid. InChIKey: UCZCRVLJNIJMEI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO3
Molecular weight235.28 g/mol
IUPAC name4-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)butanoic acid
InChIKeyUCZCRVLJNIJMEI-UHFFFAOYSA-N
SMILESC1COC2=CC=CC=C2CN1CCCC(=O)O

Computed by PubChem (NCBI)