Products 1832647-27-4

CAS 1832647-27-4 is the registry number for 2-Methoxy-2-(3-methoxyphenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-methoxy-2-(3-methoxyphenyl)acetic acid (CAS 1832647-27-4) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 2-methoxy-2-(3-methoxyphenyl)acetic acid. InChIKey: MJQJGHVSTUVGEA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O4
Molecular weight196.20 g/mol
IUPAC name2-methoxy-2-(3-methoxyphenyl)acetic acid
InChIKeyMJQJGHVSTUVGEA-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1)C(C(=O)O)OC

Computed by PubChem (NCBI)