CAS 183385-06-0 is the registry number for Desthio-desacetylmethyl-7-ACA. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(6R,7S)-7-amino-3-(hydroxymethyl)-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 183385-06-0) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: (6R,7S)-7-amino-3-(hydroxymethyl)-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: YLIXZBUZUNFPFP-RITPCOANSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | (6R,7S)-7-amino-3-(hydroxymethyl)-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | YLIXZBUZUNFPFP-RITPCOANSA-N |
| SMILES | C1CC(=C(N2[C@H]1[C@@H](C2=O)N)C(=O)O)CO |
Computed by PubChem (NCBI)