Products 183483-09-2

CAS 183483-09-2 appears in our catalog under these names: 1-Boc-Piperidine-3-acetic acid 95%, (1-tert-Butoxycarbonyl-piperidin-3-yl)-acetic acid, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]acetic acid (CAS 183483-09-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]acetic acid. InChIKey: QZYGREZDLJVVSV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]acetic acid
InChIKeyQZYGREZDLJVVSV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)CC(=O)O

Computed by PubChem (NCBI)