Products 183741-98-2
CAS 183741-98-2 appears in our catalog under these names: 6-Methoxypyrido[3,4-d]pyrimidin-4(3H)-one, 98%, 6-methoxy-1H,4H-pyrido[3,4-d]pyrimidin-4-one, 98%, 6-Methoxypyrido[3,4-d]Pyrimidin-4(1H)-One, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-methoxy-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 183741-98-2) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 6-methoxy-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: SGPOZFXLPFFDQY-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 6-methoxy-3H-pyrido[3,4-d]pyrimidin-4-one |
| InChIKey | SGPOZFXLPFFDQY-UHFFFAOYSA-N |
| SMILES | COC1=NC=C2C(=C1)C(=O)NC=N2 |
Computed by PubChem (NCBI)