CAS 183892-93-5 is the registry number for CA12 modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea (CAS 183892-93-5) is a chemical compound with the molecular formula C15H17N3O3S and a molecular weight of 319.4 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea. InChIKey: SPEYBQKWONGMOH-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O3S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea |
| InChIKey | SPEYBQKWONGMOH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)NC2=CC=C(C=C2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)