Products 2578839-03-7

CAS 2578839-03-7 is the registry number for 2-(3-Cyano-1,5-dimethyl-1H-pyrazol-4-yl)ethyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-cyano-1,5-dimethylpyrazol-4-yl)ethyl 4-methylbenzenesulfonate (CAS 2578839-03-7) is a chemical compound with the molecular formula C15H17N3O3S and a molecular weight of 319.4 g/mol. IUPAC name: 2-(3-cyano-1,5-dimethylpyrazol-4-yl)ethyl 4-methylbenzenesulfonate. InChIKey: UYVHJMKLYASMAY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17N3O3S
Molecular weight319.4 g/mol
IUPAC name2-(3-cyano-1,5-dimethylpyrazol-4-yl)ethyl 4-methylbenzenesulfonate
InChIKeyUYVHJMKLYASMAY-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCC2=C(N(N=C2C#N)C)C

Computed by PubChem (NCBI)