CAS 2578839-03-7 is the registry number for 2-(3-Cyano-1,5-dimethyl-1H-pyrazol-4-yl)ethyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-cyano-1,5-dimethylpyrazol-4-yl)ethyl 4-methylbenzenesulfonate (CAS 2578839-03-7) is a chemical compound with the molecular formula C15H17N3O3S and a molecular weight of 319.4 g/mol. IUPAC name: 2-(3-cyano-1,5-dimethylpyrazol-4-yl)ethyl 4-methylbenzenesulfonate. InChIKey: UYVHJMKLYASMAY-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O3S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-(3-cyano-1,5-dimethylpyrazol-4-yl)ethyl 4-methylbenzenesulfonate |
| InChIKey | UYVHJMKLYASMAY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2=C(N(N=C2C#N)C)C |
Computed by PubChem (NCBI)