Products 2758231-56-8
CAS 2758231-56-8 is the registry number for Carbonic anhydrase inhibitor 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-benzyl-1-methyl-3-(3-sulfamoylphenyl)urea (CAS 2758231-56-8) is a chemical compound with the molecular formula C15H17N3O3S and a molecular weight of 319.4 g/mol. IUPAC name: 1-benzyl-1-methyl-3-(3-sulfamoylphenyl)urea. InChIKey: HSRTVRBOFWARDD-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O3S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1-benzyl-1-methyl-3-(3-sulfamoylphenyl)urea |
| InChIKey | HSRTVRBOFWARDD-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C(=O)NC2=CC(=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)