Products 184041-19-8
CAS 184041-19-8 appears in our catalog under these names: 6-Bromo-3,3-dimethyl-1,2,3,4-tetrahydroquinoline, 98%, 98%, 6-BROMO-3,3-DIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-3,3-dimethyl-2,4-dihydro-1H-quinoline (CAS 184041-19-8) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2,4-dihydro-1H-quinoline. InChIKey: WBBNMAJXVPOTGT-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-2,4-dihydro-1H-quinoline |
| InChIKey | WBBNMAJXVPOTGT-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=CC(=C2)Br)NC1)C |
Computed by PubChem (NCBI)