CAS 1841-57-2 appears in our catalog under these names: 2-(4-Fluorophenyl)benzoic acid, 98%, 4'-Fluoro-biphenyl-2-carboxylic acid, 98%, 4'-Fluoro-(1,1'-biphenyl)-2-carboxylic acid, 98%. Offered by: Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 25g, 5g, 1g, 250mg.
2-(4-fluorophenyl)benzoic acid (CAS 1841-57-2) is a chemical compound with the molecular formula C13H9FO2 and a molecular weight of 216.21 g/mol. IUPAC name: 2-(4-fluorophenyl)benzoic acid. InChIKey: LGVNEKHPDXUTKA-UHFFFAOYSA-N.
| Molecular formula | C13H9FO2 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 2-(4-fluorophenyl)benzoic acid |
| InChIKey | LGVNEKHPDXUTKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)