CAS 184150-81-0 is the registry number for 2-ETHYL-1H-INDOLE-6-CARBOXYLIC ACID METHYL ESTER, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-ethyl-1H-indole-6-carboxylate (CAS 184150-81-0) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: methyl 2-ethyl-1H-indole-6-carboxylate. InChIKey: DETYGYFLEMGFIB-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | methyl 2-ethyl-1H-indole-6-carboxylate |
| InChIKey | DETYGYFLEMGFIB-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(N1)C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)