CAS 18423-13-7 is the registry number for 4–Hydroxy–3–methoxy–5–(3–methyl–2–buten–1–yl)benzaldehyde. Offered by: GLPBio. Available pack sizes: 1g.
4-hydroxy-3-methoxy-5-(3-methylbut-2-enyl)benzaldehyde (CAS 18423-13-7) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 4-hydroxy-3-methoxy-5-(3-methylbut-2-enyl)benzaldehyde. InChIKey: CKJCGNYKNJFKLA-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 4-hydroxy-3-methoxy-5-(3-methylbut-2-enyl)benzaldehyde |
| InChIKey | CKJCGNYKNJFKLA-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=CC(=C1)C=O)OC)O)C |
Computed by PubChem (NCBI)