CAS 18436-63-0 appears in our catalog under these names: 1-(2,2-Dimethoxyethyl)-2,4-dinitrobenzene, 95%, 1-(2,2-Dimethoxyethyl)-2,4-dinitrobenzene, ≥95%, ≥95%, 1-(2,2-DIMETHOXYETHYL)-2,4-DINITROBENZENE, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 1g.
1-(2,2-dimethoxyethyl)-2,4-dinitrobenzene (CAS 18436-63-0) is a chemical compound with the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. IUPAC name: 1-(2,2-dimethoxyethyl)-2,4-dinitrobenzene. InChIKey: SYEGODRAXPHXPS-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O6 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | 1-(2,2-dimethoxyethyl)-2,4-dinitrobenzene |
| InChIKey | SYEGODRAXPHXPS-UHFFFAOYSA-N |
| SMILES | COC(CC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])OC |
Computed by PubChem (NCBI)