Products 7126-27-4
CAS 7126-27-4 appears in our catalog under these names: N,N'-Ethylenebis(maleamic Acid), >98.0%(HPLC), 3-[2-(3-carboxyprop-2-enoylamino)ethylcarbamoyl]prop-2-enoic acid. Offered by: TCI, Chemat. Available pack sizes: 1g, 100mg.
(E)-4-[2-[[(E)-3-carboxyprop-2-enoyl]amino]ethylamino]-4-oxobut-2-enoic acid (CAS 7126-27-4) is a chemical compound with the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. IUPAC name: (E)-4-[2-[[(E)-3-carboxyprop-2-enoyl]amino]ethylamino]-4-oxobut-2-enoic acid. InChIKey: OYNNHEMQCZQNEW-ZPUQHVIOSA-N.
| Molecular formula | C10H12N2O6 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | (E)-4-[2-[[(E)-3-carboxyprop-2-enoyl]amino]ethylamino]-4-oxobut-2-enoic acid |
| InChIKey | OYNNHEMQCZQNEW-ZPUQHVIOSA-N |
| SMILES | C(NC(=O)/C=C/C(=O)O)CNC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)