CAS 207612-92-8 is the registry number for Mal-CH2CH2-N-(CH2-COOH)2. Offered by: Iris Biotech. Available pack sizes: on request.
2-[carboxymethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetic acid (CAS 207612-92-8) is a chemical compound with the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. IUPAC name: 2-[carboxymethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetic acid. InChIKey: YXZKLBWQSVZIDK-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O6 |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | 2-[carboxymethyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetic acid |
| InChIKey | YXZKLBWQSVZIDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCN(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)