CAS 18448-83-4 is the registry number for 4-Amino-2,5-dichlorobenzonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-2,5-dichlorobenzonitrile (CAS 18448-83-4) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 4-amino-2,5-dichlorobenzonitrile. InChIKey: VFZOPOZDIBQSJG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 4-amino-2,5-dichlorobenzonitrile |
| InChIKey | VFZOPOZDIBQSJG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)N)Cl)C#N |
Computed by PubChem (NCBI)