Products 1845694-34-9
CAS 1845694-34-9 is the registry number for 5’-(Trifluoromethyl)-2H-[1,2’-bipyridin]-2-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one (CAS 1845694-34-9) is a chemical compound with the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one. InChIKey: ZBKHCRLOSOZXJB-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
| InChIKey | ZBKHCRLOSOZXJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1)C2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)