CAS 1845696-05-0 is the registry number for 2-(2-Bromo-5-chlorophenoxy)acetohydrazide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2-bromo-5-chlorophenoxy)acetohydrazide (CAS 1845696-05-0) is a chemical compound with the molecular formula C8H8BrClN2O2 and a molecular weight of 279.52 g/mol. IUPAC name: 2-(2-bromo-5-chlorophenoxy)acetohydrazide. InChIKey: PVIPCGJDRGXDDJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O2 |
|---|---|
| Molecular weight | 279.52 g/mol |
| IUPAC name | 2-(2-bromo-5-chlorophenoxy)acetohydrazide |
| InChIKey | PVIPCGJDRGXDDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCC(=O)NN)Br |
Computed by PubChem (NCBI)