CAS 2288708-61-0 appears in our catalog under these names: 2-Acetamido-5-bromo-3-chloro-6-methoxypyridine, 95%, N-(5-Bromo-3-chloro-6-methoxypyridin-2-yl)acetamide, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-(5-bromo-3-chloro-6-methoxy-2-pyridinyl)acetamide (CAS 2288708-61-0) is a chemical compound with the molecular formula C8H8BrClN2O2 and a molecular weight of 279.52 g/mol. IUPAC name: N-(5-bromo-3-chloro-6-methoxy-2-pyridinyl)acetamide. InChIKey: VAUMGSHPOQBKHD-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O2 |
|---|---|
| Molecular weight | 279.52 g/mol |
| IUPAC name | N-(5-bromo-3-chloro-6-methoxy-2-pyridinyl)acetamide |
| InChIKey | VAUMGSHPOQBKHD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=C(C=C1Cl)Br)OC |
Computed by PubChem (NCBI)