CAS 885223-63-2 appears in our catalog under these names: 5-Bromo-2-chloro-N-methoxy-N-methylnicotinamide, N-Methoxy-N-methyl 5-bromo-2-chloronicotinamide, 96%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 25g, 5g.
5-bromo-2-chloro-N-methoxy-N-methylpyridine-3-carboxamide (CAS 885223-63-2) is a chemical compound with the molecular formula C8H8BrClN2O2 and a molecular weight of 279.52 g/mol. IUPAC name: 5-bromo-2-chloro-N-methoxy-N-methylpyridine-3-carboxamide. InChIKey: HICOBHUDWNSYTJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O2 |
|---|---|
| Molecular weight | 279.52 g/mol |
| IUPAC name | 5-bromo-2-chloro-N-methoxy-N-methylpyridine-3-carboxamide |
| InChIKey | HICOBHUDWNSYTJ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(N=CC(=C1)Br)Cl)OC |
Computed by PubChem (NCBI)