CAS 184650-02-0 appears in our catalog under these names: 5'-(3-Aminophenyl)-[1,1':3',1''-terphenyl]-3,3''-diamine 97%, 5'-(3-Aminophenyl)-[1,1':3',1''-terphenyl]-3,3''-diamine, 97%, 97%, 5'-(3-Aminophenyl)-[1,1':3',1"-terphenyl]-3,3"-diamine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-[3,5-bis(3-aminophenyl)phenyl]aniline (CAS 184650-02-0) is a chemical compound with the molecular formula C24H21N3 and a molecular weight of 351.4 g/mol. IUPAC name: 3-[3,5-bis(3-aminophenyl)phenyl]aniline. InChIKey: NMBMQQDNMNJFPG-UHFFFAOYSA-N.
| Molecular formula | C24H21N3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 3-[3,5-bis(3-aminophenyl)phenyl]aniline |
| InChIKey | NMBMQQDNMNJFPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=CC(=C2)C3=CC(=CC=C3)N)C4=CC(=CC=C4)N |
Computed by PubChem (NCBI)