Products 184653-84-7
CAS 184653-84-7 appears in our catalog under these names: Carabersat, Carabersat, 98.22%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 10 mg, 10mM/1mL, 50 mg, 100 mg.
N-[(3R,4S)-6-acetyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4-fluorobenzamide (CAS 184653-84-7) is a chemical compound with the molecular formula C20H20FNO4 and a molecular weight of 357.4 g/mol. IUPAC name: N-[(3R,4S)-6-acetyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4-fluorobenzamide. InChIKey: RCLXAPJEFHPYEG-ZWKOTPCHSA-N.
| Molecular formula | C20H20FNO4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-[(3R,4S)-6-acetyl-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4-fluorobenzamide |
| InChIKey | RCLXAPJEFHPYEG-ZWKOTPCHSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)OC([C@@H]([C@H]2NC(=O)C3=CC=C(C=C3)F)O)(C)C |
Computed by PubChem (NCBI)