Products 2350310-77-7
CAS 2350310-77-7 is the registry number for (2S)-2-Fmoc-amino-5-fluoropentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-fluoropentanoic acid (CAS 2350310-77-7) is a chemical compound with the molecular formula C20H20FNO4 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-fluoropentanoic acid. InChIKey: STIMERJJIUNUER-SFHVURJKSA-N.
| Molecular formula | C20H20FNO4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-fluoropentanoic acid |
| InChIKey | STIMERJJIUNUER-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCF)C(=O)O |
Computed by PubChem (NCBI)