CAS 439080-96-3 is the registry number for 3-(5-(4-Fluorophenyl)-5-hydroxy-1-oxopentyl)-4-phenyl-2-oxazolidinone. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 2000mg.
3-[5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phenyl-1,3-oxazolidin-2-one (CAS 439080-96-3) is a chemical compound with the molecular formula C20H20FNO4 and a molecular weight of 357.4 g/mol. IUPAC name: 3-[5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phenyl-1,3-oxazolidin-2-one. InChIKey: AVAZNWOHQJYCEL-UHFFFAOYSA-N.
| Molecular formula | C20H20FNO4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 3-[5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| InChIKey | AVAZNWOHQJYCEL-UHFFFAOYSA-N |
| SMILES | C1C(N(C(=O)O1)C(=O)CCCC(C2=CC=C(C=C2)F)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)