CAS 1846630-71-4 appears in our catalog under these names: (4S)-4-{((Benzyloxy)carbonyl)amino}-5,5,5-trifluoropentanoic acid, (4S)-4-{((benzyloxy)carbonyl)amino}-5,5,5-trifluoropentanoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
(4S)-5,5,5-trifluoro-4-(phenylmethoxycarbonylamino)pentanoic acid (CAS 1846630-71-4) is a chemical compound with the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. IUPAC name: (4S)-5,5,5-trifluoro-4-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: HGRWZNXUNKVNMS-JTQLQIEISA-N.
| Molecular formula | C13H14F3NO4 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | (4S)-5,5,5-trifluoro-4-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | HGRWZNXUNKVNMS-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)