CAS 18504-70-6 appears in our catalog under these names: 1-[Chloro(phenyl)acetyl]piperidine, 95%, 2-Chloro-2-phenyl-1-(piperidin-1-yl)ethan-1-one, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-chloro-2-phenyl-1-piperidin-1-ylethanone (CAS 18504-70-6) is a chemical compound with the molecular formula C13H16ClNO and a molecular weight of 237.72 g/mol. IUPAC name: 2-chloro-2-phenyl-1-piperidin-1-ylethanone. InChIKey: ACZICANKVRIYSF-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | 2-chloro-2-phenyl-1-piperidin-1-ylethanone |
| InChIKey | ACZICANKVRIYSF-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C(C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)