CAS 57707-20-7 is the registry number for N-Cyclohexyl 4-chlorobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
4-chloro-N-cyclohexylbenzamide (CAS 57707-20-7) is a chemical compound with the molecular formula C13H16ClNO and a molecular weight of 237.72 g/mol. IUPAC name: 4-chloro-N-cyclohexylbenzamide. InChIKey: KSXFAESIEUQWLY-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | 4-chloro-N-cyclohexylbenzamide |
| InChIKey | KSXFAESIEUQWLY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)