Products 51872-03-8

CAS 51872-03-8 is the registry number for [1-(6-Methoxy-2-naphthyl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(6-methoxynaphthalen-2-yl)ethanamine;hydrochloride (CAS 51872-03-8) is a chemical compound with the molecular formula C13H16ClNO and a molecular weight of 237.72 g/mol. IUPAC name: 1-(6-methoxynaphthalen-2-yl)ethanamine;hydrochloride. InChIKey: IUQPLZORRBTNOM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClNO
Molecular weight237.72 g/mol
IUPAC name1-(6-methoxynaphthalen-2-yl)ethanamine;hydrochloride
InChIKeyIUQPLZORRBTNOM-UHFFFAOYSA-N
SMILESCC(C1=CC2=C(C=C1)C=C(C=C2)OC)N.Cl

Computed by PubChem (NCBI)