Products 1851753-10-0
CAS 1851753-10-0 is the registry number for Cyclopropyl(4-fluoro-2,5-dimethylphenyl)methanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-(4-fluoro-2,5-dimethylphenyl)methanone (CAS 1851753-10-0) is a chemical compound with the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. IUPAC name: cyclopropyl-(4-fluoro-2,5-dimethylphenyl)methanone. InChIKey: NQZQDNFIELODOZ-UHFFFAOYSA-N.
| Molecular formula | C12H13FO |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | cyclopropyl-(4-fluoro-2,5-dimethylphenyl)methanone |
| InChIKey | NQZQDNFIELODOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)C)C(=O)C2CC2 |
Computed by PubChem (NCBI)