Products 18519-99-8
CAS 18519-99-8 is the registry number for 4-Ethyl-6-hydroxy-2-oxo-1,2-dihydropyridine-3,5-dicarbonitrile, ammonia salt, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Azane;4-ethyl-2-hydroxy-6-oxo-1H-pyridine-3,5-dicarbonitrile (CAS 18519-99-8) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: azane;4-ethyl-2-hydroxy-6-oxo-1H-pyridine-3,5-dicarbonitrile. InChIKey: HYNJPSKDOZSXNX-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | azane;4-ethyl-2-hydroxy-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| InChIKey | HYNJPSKDOZSXNX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=O)NC(=C1C#N)O)C#N.N |
Computed by PubChem (NCBI)