Products 851116-20-6

CAS 851116-20-6 is the registry number for (5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid (CAS 851116-20-6) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid. InChIKey: OXMKLBYGIXUDJP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N4O2
Molecular weight206.20 g/mol
IUPAC name2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid
InChIKeyOXMKLBYGIXUDJP-UHFFFAOYSA-N
SMILESCC1=C(C(=NC2=NC=NN12)C)CC(=O)O

Computed by PubChem (NCBI)