CAS 851116-20-6 appears in our catalog under these names: (5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid, 95%, 2-{5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl}acetic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid (CAS 851116-20-6) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid. InChIKey: OXMKLBYGIXUDJP-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid |
| InChIKey | OXMKLBYGIXUDJP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=NC=NN12)C)CC(=O)O |
Computed by PubChem (NCBI)